C16H32O8 — CID 173084491
2,3-dihydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid;ethoxyethane;bis(prop-1-ene) (PubChem CID 173084491) has the molecular formula C16H32O8 and a molecular weight of 352.42 g/mol. Its IUPAC name is 2,3-dihydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid;ethoxyethane;bis(prop-1-ene).
| Compound Name | 2,3-dihydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid;ethoxyethane;bis(prop-1-ene) |
|---|---|
| PubChem CID | 173084491 |
| Molecular Formula | C16H32O8 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 2,3-dihydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid;ethoxyethane;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.CCOCC.O=C(O)C(O)C(O)C(=O)OCCO |
| InChI | InChI=1S/C6H10O7.C4H10O.2C3H6/c7-1-2-13-6(12)4(9)3(8)5(10)11;1-3-5-4-2;2*1-3-2/h3-4,7-9H,1-2H2,(H,10,11);3-4H2,1-2H3;2*3H,1H2,2H3 |
| InChIKey | ACIQANFHFAEJET-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|