C13H29NO6 — CID 135223188
ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;prop-2-enamide (PubChem CID 135223188) has the molecular formula C13H29NO6 and a molecular weight of 295.38 g/mol. Its IUPAC name is ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;prop-2-enamide.
| Compound Name | ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;prop-2-enamide |
|---|---|
| PubChem CID | 135223188 |
| Molecular Formula | C13H29NO6 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;prop-2-enamide |
| SMILES | C=CC(N)=O.CCOCC.OCCOCCOCCO |
| InChI | InChI=1S/C6H14O4.C4H10O.C3H5NO/c7-1-3-9-5-6-10-4-2-8;1-3-5-4-2;1-2-3(4)5/h7-8H,1-6H2;3-4H2,1-2H3;2H,1H2,(H2,4,5) |
| InChIKey | ICEMWSIRELAUHC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|