About 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate
2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate (PubChem CID 156687732) has the molecular formula C9H19NO5
and a molecular weight of 221.25 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate |
| PubChem CID | 156687732 |
| Molecular Formula | C9H19NO5 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate |
| SMILES | CC(O)CC(N)C(=O)OCCOCCO |
| InChI | InChI=1S/C9H19NO5/c1-7(12)6-8(10)9(13)15-5-4-14-3-2-11/h7-8,11-12H,2-6,10H2,1H3 |
| InChIKey | AJRBPKIOZKDHGY-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate?
The IUPAC name of 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate (CID 156687732) is 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate?
The canonical SMILES for 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate is CC(O)CC(N)C(=O)OCCOCCO.
What is the InChIKey of 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate?
The InChIKey is AJRBPKIOZKDHGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO5/c1-7(12)6-8(10)9(13)15-5-4-14-3-2-11/h7-8,11-12H,2-6,10H2,1H3.
What are the key properties of 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate?
2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate has a molecular weight of 221.25 g/mol, XLogP of -1.36, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethyl 2-amino-4-hydroxypentanoate is sourced from PubChem (CID 156687732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).