C7H11NO3S2 — CID 43827766
O-ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate (PubChem CID 43827766) has the molecular formula C7H11NO3S2 and a molecular weight of 221.30 g/mol. Its IUPAC name is O-ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate.
| Compound Name | O-ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate |
|---|---|
| PubChem CID | 43827766 |
| Molecular Formula | C7H11NO3S2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | O-ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate |
| SMILES | CCOC(=S)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C7H11NO3S2/c1-2-11-7(12)8-6-3-4-13(9,10)5-6/h3-4,6H,2,5H2,1H3,(H,8,12) |
| InChIKey | VNKUVTRNIIHHJR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|