C14H17NO3S2 — CID 102567003
O-(2-propan-2-ylphenyl) N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate (PubChem CID 102567003) has the molecular formula C14H17NO3S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is O-(2-propan-2-ylphenyl) N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate.
| Compound Name | O-(2-propan-2-ylphenyl) N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate |
|---|---|
| PubChem CID | 102567003 |
| Molecular Formula | C14H17NO3S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | O-(2-propan-2-ylphenyl) N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate |
| SMILES | CC(C)c1ccccc1OC(=S)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17NO3S2/c1-10(2)12-5-3-4-6-13(12)18-14(19)15-11-7-8-20(16,17)9-11/h3-8,10-11H,9H2,1-2H3,(H,15,19) |
| InChIKey | WNQBZHOAGBDEDZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|