C21H30O4 — CID 91722262
1-O-(2-methylpropyl) 2-O-(2-propan-2-ylphenyl) cyclohexane-1,2-dicarboxylate (PubChem CID 91722262) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-O-(2-methylpropyl) 2-O-(2-propan-2-ylphenyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-(2-methylpropyl) 2-O-(2-propan-2-ylphenyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91722262 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-O-(2-methylpropyl) 2-O-(2-propan-2-ylphenyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CC(C)COC(=O)C1CCCCC1C(=O)Oc1ccccc1C(C)C |
| InChI | InChI=1S/C21H30O4/c1-14(2)13-24-20(22)17-10-5-6-11-18(17)21(23)25-19-12-8-7-9-16(19)15(3)4/h7-9,12,14-15,17-18H,5-6,10-11,13H2,1-4H3 |
| InChIKey | ZNBBEVRBWHGRPU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|