C26H44O8 — CID 23444116
tetrakis(2-methylpropyl) cyclohexane-1,2,4,5-tetracarboxylate (PubChem CID 23444116) has the molecular formula C26H44O8 and a molecular weight of 484.63 g/mol. Its IUPAC name is tetrakis(2-methylpropyl) cyclohexane-1,2,4,5-tetracarboxylate.
| Compound Name | tetrakis(2-methylpropyl) cyclohexane-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 23444116 |
| Molecular Formula | C26H44O8 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | tetrakis(2-methylpropyl) cyclohexane-1,2,4,5-tetracarboxylate |
| SMILES | CC(C)COC(=O)C1CC(C(=O)OCC(C)C)C(C(=O)OCC(C)C)CC1C(=O)OCC(C)C |
| InChI | InChI=1S/C26H44O8/c1-15(2)11-31-23(27)19-9-21(25(29)33-13-17(5)6)22(26(30)34-14-18(7)8)10-20(19)24(28)32-12-16(3)4/h15-22H,9-14H2,1-8H3 |
| InChIKey | JYKJHYKJAYVHBS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|