C16H24O4 — CID 22348399
bis(2-methylpropyl) cyclohexa-3,5-diene-1,2-dicarboxylate (PubChem CID 22348399) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is bis(2-methylpropyl) cyclohexa-3,5-diene-1,2-dicarboxylate.
| Compound Name | bis(2-methylpropyl) cyclohexa-3,5-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22348399 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | bis(2-methylpropyl) cyclohexa-3,5-diene-1,2-dicarboxylate |
| SMILES | CC(C)COC(=O)C1C=CC=CC1C(=O)OCC(C)C |
| InChI | InChI=1S/C16H24O4/c1-11(2)9-19-15(17)13-7-5-6-8-14(13)16(18)20-10-12(3)4/h5-8,11-14H,9-10H2,1-4H3 |
| InChIKey | UQIKSJHVIFALIH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |