6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid

C12H16O4 — CID 22348401

IUPAC6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid
SMILESCC(C)COC(=O)C1C=CC=CC1C(=O)O
InChIInChI=1S/C12H16O4/c1-8(2)7-16-12(15)10-6-4-3-5-9(10)11(13)14/h3-6,8-10H,7H2,1-2H3,(H,13,14)
InChIKeyXQYKYNYUXJSZIO-UHFFFAOYSA-N
MW224.26 g/mol
LogP1.63
Rot. Bonds4

About 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid

6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 22348401) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid
PubChem CID22348401
Molecular FormulaC12H16O4
Molecular Weight224.26 g/mol
Exact Mass224.10
IUPAC Name6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid
SMILESCC(C)COC(=O)C1C=CC=CC1C(=O)O
InChIInChI=1S/C12H16O4/c1-8(2)7-16-12(15)10-6-4-3-5-9(10)11(13)14/h3-6,8-10H,7H2,1-2H3,(H,13,14)
InChIKeyXQYKYNYUXJSZIO-UHFFFAOYSA-N
XLogP1.63
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.26
LogP ≤ 51.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid (CID 22348401) is 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid is CC(C)COC(=O)C1C=CC=CC1C(=O)O.
What is the InChIKey of 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is XQYKYNYUXJSZIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-8(2)7-16-12(15)10-6-4-3-5-9(10)11(13)14/h3-6,8-10H,7H2,1-2H3,(H,13,14).
What are the key properties of 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid?
6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 224.26 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylpropoxycarbonyl)cyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 22348401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).