About 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid
6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 121283248) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid.
Analyze 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid (CID 121283248) is 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid is CN(C)C1C=CC=CC1C(=O)O.
What is the InChIKey of 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is UKKSTNTYEJJDMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-8H,1-2H3,(H,11,12).
What are the key properties of 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid?
6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 167.21 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)cyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 121283248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).