About 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid
6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 135293112) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid.
Analyze 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid (CID 135293112) is 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid is CC1=CC(N)C(C(=O)O)C=C1.
What is the InChIKey of 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is SCMZFPNAMIATEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4,6-7H,9H2,1H3,(H,10,11).
What are the key properties of 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid?
6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 153.18 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-methylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 135293112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).