C10H19NO3 — CID 69229435
2-methylpropyl (2S)-4-hydroxy-1-methylpyrrolidine-2-carboxylate (PubChem CID 69229435) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-methylpropyl (2S)-4-hydroxy-1-methylpyrrolidine-2-carboxylate.
| Compound Name | 2-methylpropyl (2S)-4-hydroxy-1-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 69229435 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-methylpropyl (2S)-4-hydroxy-1-methylpyrrolidine-2-carboxylate |
| SMILES | CC(C)COC(=O)[C@@H]1CC(O)CN1C |
| InChI | InChI=1S/C10H19NO3/c1-7(2)6-14-10(13)9-4-8(12)5-11(9)3/h7-9,12H,4-6H2,1-3H3/t8?,9-/m0/s1 |
| InChIKey | DHPIZCJAGPJAAN-GKAPJAKFSA-N |
| XLogP | 0.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |