C20H27FO4 — CID 91721798
2-O-(2-fluorophenyl) 1-O-(4-methylpentyl) cyclohexane-1,2-dicarboxylate (PubChem CID 91721798) has the molecular formula C20H27FO4 and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-O-(2-fluorophenyl) 1-O-(4-methylpentyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 2-O-(2-fluorophenyl) 1-O-(4-methylpentyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91721798 |
| Molecular Formula | C20H27FO4 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-O-(2-fluorophenyl) 1-O-(4-methylpentyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CC(C)CCCOC(=O)C1CCCCC1C(=O)Oc1ccccc1F |
| InChI | InChI=1S/C20H27FO4/c1-14(2)8-7-13-24-19(22)15-9-3-4-10-16(15)20(23)25-18-12-6-5-11-17(18)21/h5-6,11-12,14-16H,3-4,7-10,13H2,1-2H3 |
| InChIKey | DTRNYKHZJCXWGP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|