C21H25NO4S — CID 166296285
N-(1,1-dioxothian-4-yl)-4-(2-propan-2-ylphenoxy)benzamide (PubChem CID 166296285) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-4-(2-propan-2-ylphenoxy)benzamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-4-(2-propan-2-ylphenoxy)benzamide |
|---|---|
| PubChem CID | 166296285 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-4-(2-propan-2-ylphenoxy)benzamide |
| SMILES | CC(C)c1ccccc1Oc1ccc(C(=O)NC2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-15(2)19-5-3-4-6-20(19)26-18-9-7-16(8-10-18)21(23)22-17-11-13-27(24,25)14-12-17/h3-10,15,17H,11-14H2,1-2H3,(H,22,23) |
| InChIKey | BQDUEMSNLKCIIK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |