C19H20N2O5S — CID 109048157
1-N-(1,1-dioxothiolan-3-yl)-4-N-(3-methoxyphenyl)benzene-1,4-dicarboxamide (PubChem CID 109048157) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-N-(1,1-dioxothiolan-3-yl)-4-N-(3-methoxyphenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-(1,1-dioxothiolan-3-yl)-4-N-(3-methoxyphenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109048157 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1-N-(1,1-dioxothiolan-3-yl)-4-N-(3-methoxyphenyl)benzene-1,4-dicarboxamide |
| SMILES | COc1cccc(NC(=O)c2ccc(C(=O)NC3CCS(=O)(=O)C3)cc2)c1 |
| InChI | InChI=1S/C19H20N2O5S/c1-26-17-4-2-3-15(11-17)20-18(22)13-5-7-14(8-6-13)19(23)21-16-9-10-27(24,25)12-16/h2-8,11,16H,9-10,12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | LKOQLOFUSOGDGF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |