C19H21NO5S — CID 18837889
N-(1,1-dioxothiolan-3-yl)-2-(4-phenoxyphenoxy)propanamide (PubChem CID 18837889) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(4-phenoxyphenoxy)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(4-phenoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 18837889 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(4-phenoxyphenoxy)propanamide |
| SMILES | CC(Oc1ccc(Oc2ccccc2)cc1)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21NO5S/c1-14(19(21)20-15-11-12-26(22,23)13-15)24-17-7-9-18(10-8-17)25-16-5-3-2-4-6-16/h2-10,14-15H,11-13H2,1H3,(H,20,21) |
| InChIKey | PDLCBCGLGAKJNQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |