C11H12N2O3S2 — CID 43827942
1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-(4-hydroxyphenyl)thiourea (PubChem CID 43827942) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-(4-hydroxyphenyl)thiourea.
| Compound Name | 1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-(4-hydroxyphenyl)thiourea |
|---|---|
| PubChem CID | 43827942 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-(4-hydroxyphenyl)thiourea |
| SMILES | O=S1(=O)C=CC(NC(=S)Nc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C11H12N2O3S2/c14-10-3-1-8(2-4-10)12-11(17)13-9-5-6-18(15,16)7-9/h1-6,9,14H,7H2,(H2,12,13,17) |
| InChIKey | YVXOEDVUOPOCFY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|