About 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea
1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea (PubChem CID 102566915) has the molecular formula C11H12N2O4S3
and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea |
| PubChem CID | 102566915 |
| Molecular Formula | C11H12N2O4S3 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea |
| SMILES | O=S1(=O)C=CC(NC(=S)NS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C11H12N2O4S3/c14-19(15)7-6-9(8-19)12-11(18)13-20(16,17)10-4-2-1-3-5-10/h1-7,9H,8H2,(H2,12,13,18) |
| InChIKey | MKLBNEDSNCFGNK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea?
The IUPAC name of 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea (CID 102566915) is 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea.
What is the SMILES notation for 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea?
The canonical SMILES for 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea is O=S1(=O)C=CC(NC(=S)NS(=O)(=O)c2ccccc2)C1.
What is the InChIKey of 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea?
The InChIKey is MKLBNEDSNCFGNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4S3/c14-19(15)7-6-9(8-19)12-11(18)13-20(16,17)10-4-2-1-3-5-10/h1-7,9H,8H2,(H2,12,13,18).
What are the key properties of 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea?
1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea has a molecular weight of 332.43 g/mol, XLogP of 0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea is sourced from PubChem (CID 102566915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).