C11H12N2O4S3 — CID 102566915
1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea (PubChem CID 102566915) has the molecular formula C11H12N2O4S3 and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea.
| Compound Name | 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea |
|---|---|
| PubChem CID | 102566915 |
| Molecular Formula | C11H12N2O4S3 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea |
| SMILES | O=S1(=O)C=CC(NC(=S)NS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C11H12N2O4S3/c14-19(15)7-6-9(8-19)12-11(18)13-20(16,17)10-4-2-1-3-5-10/h1-7,9H,8H2,(H2,12,13,18) |
| InChIKey | MKLBNEDSNCFGNK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|