C14H17NO5S2 — CID 166291996
(3aS,6aR)-N-(benzenesulfonyl)-2,2-dioxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene-5-carboxamide (PubChem CID 166291996) has the molecular formula C14H17NO5S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (3aS,6aR)-N-(benzenesulfonyl)-2,2-dioxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene-5-carboxamide.
| Compound Name | (3aS,6aR)-N-(benzenesulfonyl)-2,2-dioxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 166291996 |
| Molecular Formula | C14H17NO5S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (3aS,6aR)-N-(benzenesulfonyl)-2,2-dioxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene-5-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)C1C[C@@H]2CS(=O)(=O)C[C@@H]2C1 |
| InChI | InChI=1S/C14H17NO5S2/c16-14(15-22(19,20)13-4-2-1-3-5-13)10-6-11-8-21(17,18)9-12(11)7-10/h1-5,10-12H,6-9H2,(H,15,16)/t10?,11-,12+ |
| InChIKey | ZYPRRCSMMQDARB-YOGCLGLASA-N |
| XLogP | 0.56 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |