C11H12N2O5S — CID 137474003
N-(benzenesulfonyl)-4-hydroxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 137474003) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is N-(benzenesulfonyl)-4-hydroxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(benzenesulfonyl)-4-hydroxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 137474003 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-(benzenesulfonyl)-4-hydroxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1NCC(O)C1C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12N2O5S/c14-8-6-12-10(15)9(8)11(16)13-19(17,18)7-4-2-1-3-5-7/h1-5,8-9,14H,6H2,(H,12,15)(H,13,16) |
| InChIKey | HLSJGEVHZOTJLF-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|