C13H14N2O5S — CID 142978877
N-(benzenesulfonyl)-6-methyl-2,4-dioxopiperidine-3-carboxamide (PubChem CID 142978877) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is N-(benzenesulfonyl)-6-methyl-2,4-dioxopiperidine-3-carboxamide.
| Compound Name | N-(benzenesulfonyl)-6-methyl-2,4-dioxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 142978877 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(benzenesulfonyl)-6-methyl-2,4-dioxopiperidine-3-carboxamide |
| SMILES | CC1CC(=O)C(C(=O)NS(=O)(=O)c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C13H14N2O5S/c1-8-7-10(16)11(12(17)14-8)13(18)15-21(19,20)9-5-3-2-4-6-9/h2-6,8,11H,7H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | XEESBEYDOOEDNM-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|