C14H15NO5S — CID 86016968
N-(4-methylphenyl)sulfonyl-2,6-dioxocyclohexane-1-carboxamide (PubChem CID 86016968) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-2,6-dioxocyclohexane-1-carboxamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-2,6-dioxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 86016968 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-2,6-dioxocyclohexane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)C2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C14H15NO5S/c1-9-5-7-10(8-6-9)21(19,20)15-14(18)13-11(16)3-2-4-12(13)17/h5-8,13H,2-4H2,1H3,(H,15,18) |
| InChIKey | IVBHVMBOTKPCQA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|