C24H24N2O4S — CID 4963196
2-methyl-1-(4-methylphenyl)-N-(4-methylphenyl)sulfonyl-4-oxo-6,7-dihydro-5H-indole-5-carboxamide (PubChem CID 4963196) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-methyl-1-(4-methylphenyl)-N-(4-methylphenyl)sulfonyl-4-oxo-6,7-dihydro-5H-indole-5-carboxamide.
| Compound Name | 2-methyl-1-(4-methylphenyl)-N-(4-methylphenyl)sulfonyl-4-oxo-6,7-dihydro-5H-indole-5-carboxamide |
|---|---|
| PubChem CID | 4963196 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-methyl-1-(4-methylphenyl)-N-(4-methylphenyl)sulfonyl-4-oxo-6,7-dihydro-5H-indole-5-carboxamide |
| SMILES | Cc1ccc(-n2c(C)cc3c2CCC(C(=O)NS(=O)(=O)c2ccc(C)cc2)C3=O)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-15-4-8-18(9-5-15)26-17(3)14-21-22(26)13-12-20(23(21)27)24(28)25-31(29,30)19-10-6-16(2)7-11-19/h4-11,14,20H,12-13H2,1-3H3,(H,25,28) |
| InChIKey | RUPJVBQMRPOHDX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|