C17H24N2O3S — CID 27055457
(4aS,8aR)-N-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxamide (PubChem CID 27055457) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is (4aS,8aR)-N-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxamide.
| Compound Name | (4aS,8aR)-N-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 27055457 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (4aS,8aR)-N-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N2CCC[C@@H]3CCCC[C@H]32)cc1 |
| InChI | InChI=1S/C17H24N2O3S/c1-13-8-10-15(11-9-13)23(21,22)18-17(20)19-12-4-6-14-5-2-3-7-16(14)19/h8-11,14,16H,2-7,12H2,1H3,(H,18,20)/t14-,16+/m0/s1 |
| InChIKey | HRVBWCSOBNQDLR-GOEBONIOSA-N |
| XLogP | 3.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |