C15H21N3O4S — CID 110350771
4-N-methyl-1-N-(4-methylphenyl)sulfonylpiperidine-1,4-dicarboxamide (PubChem CID 110350771) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-N-methyl-1-N-(4-methylphenyl)sulfonylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-methyl-1-N-(4-methylphenyl)sulfonylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 110350771 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-N-methyl-1-N-(4-methylphenyl)sulfonylpiperidine-1,4-dicarboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)NS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C15H21N3O4S/c1-11-3-5-13(6-4-11)23(21,22)17-15(20)18-9-7-12(8-10-18)14(19)16-2/h3-6,12H,7-10H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | OAGKLXZYGJGEMU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |