C15H22N2O3S — CID 110749471
4,4-dimethyl-N-(4-methylphenyl)sulfonylpiperidine-1-carboxamide (PubChem CID 110749471) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 4,4-dimethyl-N-(4-methylphenyl)sulfonylpiperidine-1-carboxamide.
| Compound Name | 4,4-dimethyl-N-(4-methylphenyl)sulfonylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 110749471 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4,4-dimethyl-N-(4-methylphenyl)sulfonylpiperidine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N2CCC(C)(C)CC2)cc1 |
| InChI | InChI=1S/C15H22N2O3S/c1-12-4-6-13(7-5-12)21(19,20)16-14(18)17-10-8-15(2,3)9-11-17/h4-7H,8-11H2,1-3H3,(H,16,18) |
| InChIKey | PLOVEINTUPYYAF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |