C17H21N5O4S — CID 110328586
N-(4-methylphenyl)sulfonyl-4-(5-methyl-1H-pyrazole-3-carbonyl)piperazine-1-carboxamide (PubChem CID 110328586) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-4-(5-methyl-1H-pyrazole-3-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-4-(5-methyl-1H-pyrazole-3-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110328586 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-4-(5-methyl-1H-pyrazole-3-carbonyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N2CCN(C(=O)c3cc(C)[nH]n3)CC2)cc1 |
| InChI | InChI=1S/C17H21N5O4S/c1-12-3-5-14(6-4-12)27(25,26)20-17(24)22-9-7-21(8-10-22)16(23)15-11-13(2)18-19-15/h3-6,11H,7-10H2,1-2H3,(H,18,19)(H,20,24) |
| InChIKey | VPLYXPJBSCVOQE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |