C12H17N3O3S — CID 23275206
1-(4-methylphenyl)sulfonyl-3-pyrrolidin-1-ylurea (PubChem CID 23275206) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-pyrrolidin-1-ylurea.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-pyrrolidin-1-ylurea |
|---|---|
| PubChem CID | 23275206 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-pyrrolidin-1-ylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NN2CCCC2)cc1 |
| InChI | InChI=1S/C12H17N3O3S/c1-10-4-6-11(7-5-10)19(17,18)14-12(16)13-15-8-2-3-9-15/h4-7H,2-3,8-9H2,1H3,(H2,13,14,16) |
| InChIKey | FNZFNJLOBQTUMH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |