C26H39N5O6S2 — CID 66869930
1-(azepan-1-yl)-3-(4-methylphenyl)sulfonylurea;1-butyl-3-(4-methylphenyl)sulfonylurea (PubChem CID 66869930) has the molecular formula C26H39N5O6S2 and a molecular weight of 581.76 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-(4-methylphenyl)sulfonylurea;1-butyl-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-(azepan-1-yl)-3-(4-methylphenyl)sulfonylurea;1-butyl-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 66869930 |
| Molecular Formula | C26H39N5O6S2 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 1-(azepan-1-yl)-3-(4-methylphenyl)sulfonylurea;1-butyl-3-(4-methylphenyl)sulfonylurea |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(C)cc1.Cc1ccc(S(=O)(=O)NC(=O)NN2CCCCCC2)cc1 |
| InChI | InChI=1S/C14H21N3O3S.C12H18N2O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17;1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18);5-8H,3-4,9H2,1-2H3,(H2,13,14,15) |
| InChIKey | USQKTVHJZNKNCB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|