C21H23ClN4O4S — CID 46243210
1-butyl-3-[4-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]phenyl]sulfonylurea (PubChem CID 46243210) has the molecular formula C21H23ClN4O4S and a molecular weight of 462.96 g/mol. Its IUPAC name is 1-butyl-3-[4-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]phenyl]sulfonylurea.
| Compound Name | 1-butyl-3-[4-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]phenyl]sulfonylurea |
|---|---|
| PubChem CID | 46243210 |
| Molecular Formula | C21H23ClN4O4S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1-butyl-3-[4-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]phenyl]sulfonylurea |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(N2N=C(c3ccc(Cl)cc3)CCC2=O)cc1 |
| InChI | InChI=1S/C21H23ClN4O4S/c1-2-3-14-23-21(28)25-31(29,30)18-10-8-17(9-11-18)26-20(27)13-12-19(24-26)15-4-6-16(22)7-5-15/h4-11H,2-3,12-14H2,1H3,(H2,23,25,28) |
| InChIKey | XABHCDUDCYTQPJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|