C14H25N7O3S — CID 176531808
1-butyl-3-(4-methylphenyl)sulfonylurea;1-carbamimidoylguanidine (PubChem CID 176531808) has the molecular formula C14H25N7O3S and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-butyl-3-(4-methylphenyl)sulfonylurea;1-carbamimidoylguanidine.
| Compound Name | 1-butyl-3-(4-methylphenyl)sulfonylurea;1-carbamimidoylguanidine |
|---|---|
| PubChem CID | 176531808 |
| Molecular Formula | C14H25N7O3S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-butyl-3-(4-methylphenyl)sulfonylurea;1-carbamimidoylguanidine |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(C)cc1.[H]/N=C(\N)N/C(N)=N/[H] |
| InChI | InChI=1S/C12H18N2O3S.C2H7N5/c1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11;3-1(4)7-2(5)6/h5-8H,3-4,9H2,1-2H3,(H2,13,14,15);(H7,3,4,5,6,7) |
| InChIKey | KUYHMKDOBNMJQC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|