C18H29N5O5S — CID 3391423
N-[4-(butylcarbamoylsulfamoyl)phenyl]-2-(carbamoylamino)-3-methylpentanamide (PubChem CID 3391423) has the molecular formula C18H29N5O5S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[4-(butylcarbamoylsulfamoyl)phenyl]-2-(carbamoylamino)-3-methylpentanamide.
| Compound Name | N-[4-(butylcarbamoylsulfamoyl)phenyl]-2-(carbamoylamino)-3-methylpentanamide |
|---|---|
| PubChem CID | 3391423 |
| Molecular Formula | C18H29N5O5S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[4-(butylcarbamoylsulfamoyl)phenyl]-2-(carbamoylamino)-3-methylpentanamide |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(NC(=O)C(NC(N)=O)C(C)CC)cc1 |
| InChI | InChI=1S/C18H29N5O5S/c1-4-6-11-20-18(26)23-29(27,28)14-9-7-13(8-10-14)21-16(24)15(12(3)5-2)22-17(19)25/h7-10,12,15H,4-6,11H2,1-3H3,(H,21,24)(H3,19,22,25)(H2,20,23,26) |
| InChIKey | ICRMLBYCFDHVIN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|