C19H27N3O7S — CID 139201721
1-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3-(4-methylphenyl)sulfonylurea;butanedioic acid (PubChem CID 139201721) has the molecular formula C19H27N3O7S and a molecular weight of 441.51 g/mol. Its IUPAC name is 1-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3-(4-methylphenyl)sulfonylurea;butanedioic acid.
| Compound Name | 1-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3-(4-methylphenyl)sulfonylurea;butanedioic acid |
|---|---|
| PubChem CID | 139201721 |
| Molecular Formula | C19H27N3O7S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3-(4-methylphenyl)sulfonylurea;butanedioic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NN2C[C@H]3CCC[C@H]3C2)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C15H21N3O3S.C4H6O4/c1-11-5-7-14(8-6-11)22(20,21)17-15(19)16-18-9-12-3-2-4-13(12)10-18;5-3(6)1-2-4(7)8/h5-8,12-13H,2-4,9-10H2,1H3,(H2,16,17,19);1-2H2,(H,5,6)(H,7,8)/t12-,13+; |
| InChIKey | ZDFLHCSKFFBKRO-OEEJBDNKSA-N |
| XLogP | 1.57 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |