C15H21N3O3S — CID 44512114
1-(1,1,3,3,5,5-hexadeuterio-3a,4,6,6a-tetrahydrocyclopenta[c]pyrrol-2-yl)-3-[4-(trideuteriomethyl)phenyl]sulfonylurea (PubChem CID 44512114) has the molecular formula C15H21N3O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-(1,1,3,3,5,5-hexadeuterio-3a,4,6,6a-tetrahydrocyclopenta[c]pyrrol-2-yl)-3-[4-(trideuteriomethyl)phenyl]sulfonylurea.
| Compound Name | 1-(1,1,3,3,5,5-hexadeuterio-3a,4,6,6a-tetrahydrocyclopenta[c]pyrrol-2-yl)-3-[4-(trideuteriomethyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 44512114 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1-(1,1,3,3,5,5-hexadeuterio-3a,4,6,6a-tetrahydrocyclopenta[c]pyrrol-2-yl)-3-[4-(trideuteriomethyl)phenyl]sulfonylurea |
| SMILES | [2H]C1([2H])CC2C(C1)C([2H])([2H])N(NC(=O)NS(=O)(=O)c1ccc(C([2H])([2H])[2H])cc1)C2([2H])[2H] |
| InChI | InChI=1S/C15H21N3O3S/c1-11-5-7-14(8-6-11)22(20,21)17-15(19)16-18-9-12-3-2-4-13(12)10-18/h5-8,12-13H,2-4,9-10H2,1H3,(H2,16,17,19)/i1D3,2D2,9D2,10D2 |
| InChIKey | BOVGTQGAOIONJV-COWIDNRPSA-N |
| XLogP | 1.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |