C12H15N3O3S — CID 142448506
4-hydroxy-N'-(2-methylsulfanylphenyl)-2-oxopyrrolidine-3-carbohydrazide (PubChem CID 142448506) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-hydroxy-N'-(2-methylsulfanylphenyl)-2-oxopyrrolidine-3-carbohydrazide.
| Compound Name | 4-hydroxy-N'-(2-methylsulfanylphenyl)-2-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 142448506 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-hydroxy-N'-(2-methylsulfanylphenyl)-2-oxopyrrolidine-3-carbohydrazide |
| SMILES | CSc1ccccc1NNC(=O)C1C(=O)NCC1O |
| InChI | InChI=1S/C12H15N3O3S/c1-19-9-5-3-2-4-7(9)14-15-12(18)10-8(16)6-13-11(10)17/h2-5,8,10,14,16H,6H2,1H3,(H,13,17)(H,15,18) |
| InChIKey | XAXXKPWTRMROTH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|