C12H14ClN3O3 — CID 142448508
N'-(3-chloro-2-methylphenyl)-4-hydroxy-2-oxopyrrolidine-3-carbohydrazide (PubChem CID 142448508) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. Its IUPAC name is N'-(3-chloro-2-methylphenyl)-4-hydroxy-2-oxopyrrolidine-3-carbohydrazide.
| Compound Name | N'-(3-chloro-2-methylphenyl)-4-hydroxy-2-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 142448508 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | N'-(3-chloro-2-methylphenyl)-4-hydroxy-2-oxopyrrolidine-3-carbohydrazide |
| SMILES | Cc1c(Cl)cccc1NNC(=O)C1C(=O)NCC1O |
| InChI | InChI=1S/C12H14ClN3O3/c1-6-7(13)3-2-4-8(6)15-16-12(19)10-9(17)5-14-11(10)18/h2-4,9-10,15,17H,5H2,1H3,(H,14,18)(H,16,19) |
| InChIKey | AHAIVLXYCKCYGY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|