C12H16Cl2N2O2 — CID 119671790
N-(3-chloro-2-methylphenyl)morpholine-2-carboxamide;hydrochloride (PubChem CID 119671790) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-(3-chloro-2-methylphenyl)morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119671790 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)morpholine-2-carboxamide;hydrochloride |
| SMILES | Cc1c(Cl)cccc1NC(=O)C1CNCCO1.Cl |
| InChI | InChI=1S/C12H15ClN2O2.ClH/c1-8-9(13)3-2-4-10(8)15-12(16)11-7-14-5-6-17-11;/h2-4,11,14H,5-7H2,1H3,(H,15,16);1H |
| InChIKey | ZFKHLDDDEHPYOF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |