C13H19ClN2O2 — CID 119679075
N-(2-ethylphenyl)morpholine-2-carboxamide;hydrochloride (PubChem CID 119679075) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is N-(2-ethylphenyl)morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-(2-ethylphenyl)morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119679075 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-(2-ethylphenyl)morpholine-2-carboxamide;hydrochloride |
| SMILES | CCc1ccccc1NC(=O)C1CNCCO1.Cl |
| InChI | InChI=1S/C13H18N2O2.ClH/c1-2-10-5-3-4-6-11(10)15-13(16)12-9-14-7-8-17-12;/h3-6,12,14H,2,7-9H2,1H3,(H,15,16);1H |
| InChIKey | XLWKZFHLBZJJJT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |