C11H11ClN2O4 — CID 142439079
N-(3-chloro-2-methylphenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide (PubChem CID 142439079) has the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 142439079 |
| Molecular Formula | C11H11ClN2O4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C1C(=O)ONC1O |
| InChI | InChI=1S/C11H11ClN2O4/c1-5-6(12)3-2-4-7(5)13-9(15)8-10(16)14-18-11(8)17/h2-4,8,10,14,16H,1H3,(H,13,15) |
| InChIKey | NKGHAZBKRLIELU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|