C11H12N2O2S — CID 107644178
3-(2-methylsulfanylanilino)pyrrolidine-2,5-dione (PubChem CID 107644178) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-(2-methylsulfanylanilino)pyrrolidine-2,5-dione.
| Compound Name | 3-(2-methylsulfanylanilino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 107644178 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-(2-methylsulfanylanilino)pyrrolidine-2,5-dione |
| SMILES | CSc1ccccc1NC1CC(=O)NC1=O |
| InChI | InChI=1S/C11H12N2O2S/c1-16-9-5-3-2-4-7(9)12-8-6-10(14)13-11(8)15/h2-5,8,12H,6H2,1H3,(H,13,14,15) |
| InChIKey | WFMSQQRASDAZLZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|