C11H10F2N2O2S — CID 43637781
3-[2-(difluoromethylsulfanyl)anilino]pyrrolidine-2,5-dione (PubChem CID 43637781) has the molecular formula C11H10F2N2O2S and a molecular weight of 272.28 g/mol. Its IUPAC name is 3-[2-(difluoromethylsulfanyl)anilino]pyrrolidine-2,5-dione.
| Compound Name | 3-[2-(difluoromethylsulfanyl)anilino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43637781 |
| Molecular Formula | C11H10F2N2O2S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3-[2-(difluoromethylsulfanyl)anilino]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2ccccc2SC(F)F)C(=O)N1 |
| InChI | InChI=1S/C11H10F2N2O2S/c12-11(13)18-8-4-2-1-3-6(8)14-7-5-9(16)15-10(7)17/h1-4,7,11,14H,5H2,(H,15,16,17) |
| InChIKey | LFQURAVAJJOXIW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|