About ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide
ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 142524494) has the molecular formula C14H20N2O6S
and a molecular weight of 344.39 g/mol. Its IUPAC name is ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide |
| PubChem CID | 142524494 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CC.COc1ccccc1S(=O)(=O)NC(=O)C1C(=O)NCC1O |
| InChI | InChI=1S/C12H14N2O6S.C2H6/c1-20-8-4-2-3-5-9(8)21(18,19)14-12(17)10-7(15)6-13-11(10)16;1-2/h2-5,7,10,15H,6H2,1H3,(H,13,16)(H,14,17);1-2H3 |
| InChIKey | NINNCAHSJGUCRU-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide?
The IUPAC name of ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide (CID 142524494) is ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide.
What is the SMILES notation for ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide?
The canonical SMILES for ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide is CC.COc1ccccc1S(=O)(=O)NC(=O)C1C(=O)NCC1O.
What is the InChIKey of ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide?
The InChIKey is NINNCAHSJGUCRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O6S.C2H6/c1-20-8-4-2-3-5-9(8)21(18,19)14-12(17)10-7(15)6-13-11(10)16;1-2/h2-5,7,10,15H,6H2,1H3,(H,13,16)(H,14,17);1-2H3.
What are the key properties of ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide?
ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide has a molecular weight of 344.39 g/mol, XLogP of -0.37, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide is sourced from PubChem (CID 142524494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).