C14H20N2O6S — CID 142524494
ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 142524494) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 142524494 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | ethane;4-hydroxy-N-(2-methoxyphenyl)sulfonyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CC.COc1ccccc1S(=O)(=O)NC(=O)C1C(=O)NCC1O |
| InChI | InChI=1S/C12H14N2O6S.C2H6/c1-20-8-4-2-3-5-9(8)21(18,19)14-12(17)10-7(15)6-13-11(10)16;1-2/h2-5,7,10,15H,6H2,1H3,(H,13,16)(H,14,17);1-2H3 |
| InChIKey | NINNCAHSJGUCRU-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|