C16H22N2O5S2 — CID 97202425
3-[[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]sulfamoyl]-N-pentan-3-ylbenzamide (PubChem CID 97202425) has the molecular formula C16H22N2O5S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-[[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]sulfamoyl]-N-pentan-3-ylbenzamide.
| Compound Name | 3-[[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]sulfamoyl]-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 97202425 |
| Molecular Formula | C16H22N2O5S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-[[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]sulfamoyl]-N-pentan-3-ylbenzamide |
| SMILES | CCC(CC)NC(=O)c1cccc(S(=O)(=O)N[C@H]2C=CS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C16H22N2O5S2/c1-3-13(4-2)17-16(19)12-6-5-7-15(10-12)25(22,23)18-14-8-9-24(20,21)11-14/h5-10,13-14,18H,3-4,11H2,1-2H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | PLXSONLVAIZJEV-AWEZNQCLSA-N |
| XLogP | 1.19 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |