C24H24N2O5S2 — CID 24536401
N-benzhydryl-3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide (PubChem CID 24536401) has the molecular formula C24H24N2O5S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-benzhydryl-3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide.
| Compound Name | N-benzhydryl-3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24536401 |
| Molecular Formula | C24H24N2O5S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-benzhydryl-3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)c1cccc(S(=O)(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C24H24N2O5S2/c27-24(25-23(18-8-3-1-4-9-18)19-10-5-2-6-11-19)20-12-7-13-22(16-20)33(30,31)26-21-14-15-32(28,29)17-21/h1-13,16,21,23,26H,14-15,17H2,(H,25,27) |
| InChIKey | MOYDFGHVCPPKPJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |