C18H16FN3O5S3 — CID 24564536
3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 24564536) has the molecular formula C18H16FN3O5S3 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 24564536 |
| Molecular Formula | C18H16FN3O5S3 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc2ccc(F)cc2s1)c1cccc(S(=O)(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C18H16FN3O5S3/c19-12-4-5-15-16(9-12)28-18(20-15)21-17(23)11-2-1-3-14(8-11)30(26,27)22-13-6-7-29(24,25)10-13/h1-5,8-9,13,22H,6-7,10H2,(H,20,21,23) |
| InChIKey | GXEMJPBLNHAYTB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |