C11H13N3O2S2 — CID 102566877
1-anilino-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea (PubChem CID 102566877) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-anilino-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea.
| Compound Name | 1-anilino-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea |
|---|---|
| PubChem CID | 102566877 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 1-anilino-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)thiourea |
| SMILES | O=S1(=O)C=CC(NC(=S)NNc2ccccc2)C1 |
| InChI | InChI=1S/C11H13N3O2S2/c15-18(16)7-6-10(8-18)12-11(17)14-13-9-4-2-1-3-5-9/h1-7,10,13H,8H2,(H2,12,14,17) |
| InChIKey | CVWLJLLOOUCQFC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|