C8H12N2O2S2 — CID 3640731
1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-prop-2-enylthiourea (PubChem CID 3640731) has the molecular formula C8H12N2O2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-prop-2-enylthiourea.
| Compound Name | 1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3640731 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C8H12N2O2S2/c1-2-4-9-8(13)10-7-3-5-14(11,12)6-7/h2-3,5,7H,1,4,6H2,(H2,9,10,13) |
| InChIKey | CSWBSPZVRXSYCG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|