C13H22N2O4S3 — CID 3780631
1-butan-2-yl-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)thiourea (PubChem CID 3780631) has the molecular formula C13H22N2O4S3 and a molecular weight of 366.53 g/mol. Its IUPAC name is 1-butan-2-yl-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)thiourea.
| Compound Name | 1-butan-2-yl-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)thiourea |
|---|---|
| PubChem CID | 3780631 |
| Molecular Formula | C13H22N2O4S3 |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-butan-2-yl-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)thiourea |
| SMILES | CCC(C)N(C(=S)NC1C=CS(=O)(=O)C1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O4S3/c1-3-10(2)15(12-5-7-22(18,19)9-12)13(20)14-11-4-6-21(16,17)8-11/h4,6,10-12H,3,5,7-9H2,1-2H3,(H,14,20) |
| InChIKey | CUGZFQJFDMLOHM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|