C11H18N2O5S3 — CID 18801591
3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-(2-hydroxyethyl)thiourea (PubChem CID 18801591) has the molecular formula C11H18N2O5S3 and a molecular weight of 354.48 g/mol. Its IUPAC name is 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-(2-hydroxyethyl)thiourea.
| Compound Name | 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 18801591 |
| Molecular Formula | C11H18N2O5S3 |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-(2-hydroxyethyl)thiourea |
| SMILES | O=S1(=O)C=CC(NC(=S)N(CCO)C2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C11H18N2O5S3/c14-4-3-13(10-2-6-21(17,18)8-10)11(19)12-9-1-5-20(15,16)7-9/h1,5,9-10,14H,2-4,6-8H2,(H,12,19) |
| InChIKey | MTRVNGRRTGZPFN-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|