C10H18N2O3S — CID 82852448
5-amino-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)hexanamide (PubChem CID 82852448) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is 5-amino-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)hexanamide.
| Compound Name | 5-amino-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)hexanamide |
|---|---|
| PubChem CID | 82852448 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5-amino-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)hexanamide |
| SMILES | CC(N)CCCC(=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N2O3S/c1-8(11)3-2-4-10(13)12-9-5-6-16(14,15)7-9/h5-6,8-9H,2-4,7,11H2,1H3,(H,12,13) |
| InChIKey | DYDWTZQSKONQPS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |